C24H43N5O5Si2 — CID 169493732
3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-N-ethyl-5-(6-oxo-1H-purin-9-yl)oxolane-2-carboxamide (PubChem CID 169493732) has the molecular formula C24H43N5O5Si2 and a molecular weight of 537.81 g/mol. Its IUPAC name is 3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-N-ethyl-5-(6-oxo-1H-purin-9-yl)oxolane-2-carboxamide.
| Compound Name | 3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-N-ethyl-5-(6-oxo-1H-purin-9-yl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 169493732 |
| Molecular Formula | C24H43N5O5Si2 |
| Molecular Weight | 537.81 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | 3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-N-ethyl-5-(6-oxo-1H-purin-9-yl)oxolane-2-carboxamide |
| SMILES | CCNC(=O)C1OC(n2cnc3c(=O)[nH]cnc32)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H43N5O5Si2/c1-12-25-21(31)17-16(33-35(8,9)23(2,3)4)18(34-36(10,11)24(5,6)7)22(32-17)29-14-28-15-19(29)26-13-27-20(15)30/h13-14,16-18,22H,12H2,1-11H3,(H,25,31)(H,26,27,30) |
| InChIKey | CNFDRKGKGOFYSV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.81 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|