C22H44INO8 — CID 170013617
N-[1-ethoxy-2-(iodomethoxymethyl)-3-propoxypropan-2-yl]-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanamide (PubChem CID 170013617) has the molecular formula C22H44INO8 and a molecular weight of 577.50 g/mol. Its IUPAC name is N-[1-ethoxy-2-(iodomethoxymethyl)-3-propoxypropan-2-yl]-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanamide.
| Compound Name | N-[1-ethoxy-2-(iodomethoxymethyl)-3-propoxypropan-2-yl]-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 170013617 |
| Molecular Formula | C22H44INO8 |
| Molecular Weight | 577.50 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | N-[1-ethoxy-2-(iodomethoxymethyl)-3-propoxypropan-2-yl]-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propanamide |
| SMILES | CCCOCCOCCOCCOCCC(=O)NC(COCC)(COCI)COCCC |
| InChI | InChI=1S/C22H44INO8/c1-4-8-27-11-13-29-15-16-30-14-12-28-10-7-21(25)24-22(17-26-6-3,19-32-20-23)18-31-9-5-2/h4-20H2,1-3H3,(H,24,25) |
| InChIKey | NOCKGXAQFFZYRG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|