About 8-tert-butyl-3,3-difluoro-8-methylcyclononyne
8-tert-butyl-3,3-difluoro-8-methylcyclononyne (PubChem CID 170029766) has the molecular formula C14H22F2
and a molecular weight of 228.33 g/mol. Its IUPAC name is 8-tert-butyl-3,3-difluoro-8-methylcyclononyne.
Molecular Properties
| Compound Name | 8-tert-butyl-3,3-difluoro-8-methylcyclononyne |
| PubChem CID | 170029766 |
| Molecular Formula | C14H22F2 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 8-tert-butyl-3,3-difluoro-8-methylcyclononyne |
| SMILES | CC(C)(C)C1(C)CC#CC(F)(F)CCCC1 |
| InChI | InChI=1S/C14H22F2/c1-12(2,3)13(4)8-5-6-10-14(15,16)11-7-9-13/h5-6,8-10H2,1-4H3 |
| InChIKey | ZMPSXULCAWTGPS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-tert-butyl-3,3-difluoro-8-methylcyclononyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-3,3-difluoro-8-methylcyclononyne?
The IUPAC name of 8-tert-butyl-3,3-difluoro-8-methylcyclononyne (CID 170029766) is 8-tert-butyl-3,3-difluoro-8-methylcyclononyne.
What is the SMILES notation for 8-tert-butyl-3,3-difluoro-8-methylcyclononyne?
The canonical SMILES for 8-tert-butyl-3,3-difluoro-8-methylcyclononyne is CC(C)(C)C1(C)CC#CC(F)(F)CCCC1.
What is the InChIKey of 8-tert-butyl-3,3-difluoro-8-methylcyclononyne?
The InChIKey is ZMPSXULCAWTGPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F2/c1-12(2,3)13(4)8-5-6-10-14(15,16)11-7-9-13/h5-6,8-10H2,1-4H3.
What are the key properties of 8-tert-butyl-3,3-difluoro-8-methylcyclononyne?
8-tert-butyl-3,3-difluoro-8-methylcyclononyne has a molecular weight of 228.33 g/mol, XLogP of 4.64, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-3,3-difluoro-8-methylcyclononyne is sourced from PubChem (CID 170029766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).