C14H22F2 — CID 170029766
8-tert-butyl-3,3-difluoro-8-methylcyclononyne (PubChem CID 170029766) has the molecular formula C14H22F2 and a molecular weight of 228.33 g/mol. Its IUPAC name is 8-tert-butyl-3,3-difluoro-8-methylcyclononyne.
| Compound Name | 8-tert-butyl-3,3-difluoro-8-methylcyclononyne |
|---|---|
| PubChem CID | 170029766 |
| Molecular Formula | C14H22F2 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 8-tert-butyl-3,3-difluoro-8-methylcyclononyne |
| SMILES | CC(C)(C)C1(C)CC#CC(F)(F)CCCC1 |
| InChI | InChI=1S/C14H22F2/c1-12(2,3)13(4)8-5-6-10-14(15,16)11-7-9-13/h5-6,8-10H2,1-4H3 |
| InChIKey | ZMPSXULCAWTGPS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|