C41H40N3+ — CID 170042770
2-[3-(12b-methyl-4,4a,5,6,11,12-hexahydro-3H-triphenylen-2-yl)cyclohexa-1,3-dien-1-yl]-1-methyl-4,6-diphenyl-1,3,5-triazin-1-ium (PubChem CID 170042770) has the molecular formula C41H40N3+ and a molecular weight of 574.79 g/mol. Its IUPAC name is 2-[3-(12b-methyl-4,4a,5,6,11,12-hexahydro-3H-triphenylen-2-yl)cyclohexa-1,3-dien-1-yl]-1-methyl-4,6-diphenyl-1,3,5-triazin-1-ium.
| Compound Name | 2-[3-(12b-methyl-4,4a,5,6,11,12-hexahydro-3H-triphenylen-2-yl)cyclohexa-1,3-dien-1-yl]-1-methyl-4,6-diphenyl-1,3,5-triazin-1-ium |
|---|---|
| PubChem CID | 170042770 |
| Molecular Formula | C41H40N3+ |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | 2-[3-(12b-methyl-4,4a,5,6,11,12-hexahydro-3H-triphenylen-2-yl)cyclohexa-1,3-dien-1-yl]-1-methyl-4,6-diphenyl-1,3,5-triazin-1-ium |
| SMILES | C[n+]1c(C2=CC(C3=CC4(C)C5=C(C=CCC5)C5=C(CCC=C5)C4CC3)=CCC2)nc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C41H40N3/c1-41-27-32(24-25-37(41)35-21-10-9-20-33(35)34-22-11-12-23-36(34)41)30-18-13-19-31(26-30)40-43-38(28-14-5-3-6-15-28)42-39(44(40)2)29-16-7-4-8-17-29/h3-9,11,14-18,20,22,26-27,37H,10,12-13,19,21,23-25H2,1-2H3/q+1 |
| InChIKey | NRZSKSZLBKMVAJ-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|