C19H20O — CID 71235187
5a-methyl-6-phenyl-2,8,9,9a-tetrahydro-1H-dibenzofuran (PubChem CID 71235187) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is 5a-methyl-6-phenyl-2,8,9,9a-tetrahydro-1H-dibenzofuran.
| Compound Name | 5a-methyl-6-phenyl-2,8,9,9a-tetrahydro-1H-dibenzofuran |
|---|---|
| PubChem CID | 71235187 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 5a-methyl-6-phenyl-2,8,9,9a-tetrahydro-1H-dibenzofuran |
| SMILES | CC12OC3=C(CCC=C3)C1CCC=C2c1ccccc1 |
| InChI | InChI=1S/C19H20O/c1-19-16(14-8-3-2-4-9-14)11-7-12-17(19)15-10-5-6-13-18(15)20-19/h2-4,6,8-9,11,13,17H,5,7,10,12H2,1H3 |
| InChIKey | OCKNJOAXDDGDTP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |