C12H10B2O4 — CID 51064170
2-(6,7-dihydro-1,3,2-benzodioxaborol-2-yl)-1,3,2-benzodioxaborole (PubChem CID 51064170) has the molecular formula C12H10B2O4 and a molecular weight of 239.83 g/mol. Its IUPAC name is 2-(6,7-dihydro-1,3,2-benzodioxaborol-2-yl)-1,3,2-benzodioxaborole.
| Compound Name | 2-(6,7-dihydro-1,3,2-benzodioxaborol-2-yl)-1,3,2-benzodioxaborole |
|---|---|
| PubChem CID | 51064170 |
| Molecular Formula | C12H10B2O4 |
| Molecular Weight | 239.83 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-(6,7-dihydro-1,3,2-benzodioxaborol-2-yl)-1,3,2-benzodioxaborole |
| SMILES | C1=CC2=C(CC1)OB(B1Oc3ccccc3O1)O2 |
| InChI | InChI=1S/C12H10B2O4/c1-2-6-10-9(5-1)15-13(16-10)14-17-11-7-3-4-8-12(11)18-14/h1-3,5-7H,4,8H2 |
| InChIKey | UMPOIAWIDCLOHR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.83 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|