C10H8BFO2 — CID 155713115
3-fluoro-2,4-dioxa-3-boratricyclo[7.3.1.05,13]trideca-1(13),5,7,9-tetraene (PubChem CID 155713115) has the molecular formula C10H8BFO2 and a molecular weight of 189.98 g/mol. Its IUPAC name is 3-fluoro-2,4-dioxa-3-boratricyclo[7.3.1.05,13]trideca-1(13),5,7,9-tetraene.
| Compound Name | 3-fluoro-2,4-dioxa-3-boratricyclo[7.3.1.05,13]trideca-1(13),5,7,9-tetraene |
|---|---|
| PubChem CID | 155713115 |
| Molecular Formula | C10H8BFO2 |
| Molecular Weight | 189.98 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 3-fluoro-2,4-dioxa-3-boratricyclo[7.3.1.05,13]trideca-1(13),5,7,9-tetraene |
| SMILES | FB1OC2=c3c(cccc3=CCC2)O1 |
| InChI | InChI=1S/C10H8BFO2/c12-11-13-8-5-1-3-7-4-2-6-9(14-11)10(7)8/h1,3-5H,2,6H2 |
| InChIKey | RBWGGHUQUDXBFK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.98 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|