C18H18B2O4 — CID 139249437
2-[(1R,2S)-2-(1,3,2-benzodioxaborol-2-yl)cyclohexyl]-1,3,2-benzodioxaborole (PubChem CID 139249437) has the molecular formula C18H18B2O4 and a molecular weight of 319.96 g/mol. Its IUPAC name is 2-[(1R,2S)-2-(1,3,2-benzodioxaborol-2-yl)cyclohexyl]-1,3,2-benzodioxaborole.
| Compound Name | 2-[(1R,2S)-2-(1,3,2-benzodioxaborol-2-yl)cyclohexyl]-1,3,2-benzodioxaborole |
|---|---|
| PubChem CID | 139249437 |
| Molecular Formula | C18H18B2O4 |
| Molecular Weight | 319.96 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-[(1R,2S)-2-(1,3,2-benzodioxaborol-2-yl)cyclohexyl]-1,3,2-benzodioxaborole |
| SMILES | c1ccc2c(c1)OB([C@H]1CCCC[C@H]1B1Oc3ccccc3O1)O2 |
| InChI | InChI=1S/C18H18B2O4/c1-2-8-14(20-23-17-11-5-6-12-18(17)24-20)13(7-1)19-21-15-9-3-4-10-16(15)22-19/h3-6,9-14H,1-2,7-8H2/t13-,14+ |
| InChIKey | LMCMORWCFPJMOY-OKILXGFUSA-N |
| XLogP | 4.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.96 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|