C25H16Cl2F2N4O4 — CID 170047251
2-[3,5-dichloro-4-[[5-fluoro-2-[(4-fluorophenyl)methyl]-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 170047251) has the molecular formula C25H16Cl2F2N4O4 and a molecular weight of 545.33 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[[5-fluoro-2-[(4-fluorophenyl)methyl]-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-[[5-fluoro-2-[(4-fluorophenyl)methyl]-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 170047251 |
| Molecular Formula | C25H16Cl2F2N4O4 |
| Molecular Weight | 545.33 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | 2-[3,5-dichloro-4-[[5-fluoro-2-[(4-fluorophenyl)methyl]-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=C1c2ccc(Oc3c(Cl)cc(-n4ncc(=O)[nH]c4=O)cc3Cl)c(F)c2CCN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H16Cl2F2N4O4/c26-18-9-15(33-25(36)31-21(34)11-30-33)10-19(27)23(18)37-20-6-5-17-16(22(20)29)7-8-32(24(17)35)12-13-1-3-14(28)4-2-13/h1-6,9-11H,7-8,12H2,(H,31,34,36) |
| InChIKey | RWHOOKXCKAEFJW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 97.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |