C10H21NO — CID 170054562
(E)-1-methoxy-N,4-dimethylhept-1-en-3-amine (PubChem CID 170054562) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is (E)-1-methoxy-N,4-dimethylhept-1-en-3-amine.
| Compound Name | (E)-1-methoxy-N,4-dimethylhept-1-en-3-amine |
|---|---|
| PubChem CID | 170054562 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (E)-1-methoxy-N,4-dimethylhept-1-en-3-amine |
| SMILES | CCCC(C)C(/C=C/OC)NC |
| InChI | InChI=1S/C10H21NO/c1-5-6-9(2)10(11-3)7-8-12-4/h7-11H,5-6H2,1-4H3/b8-7+ |
| InChIKey | YBHBXTBASXJLAB-BQYQJAHWSA-N |
| XLogP | 2.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|