C28H26ClN9O3 — CID 170057215
N-[3-amino-4-(methyliminomethyl)phenyl]-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,5-dioxopiperazin-1-yl]-3-phenylpropanamide (PubChem CID 170057215) has the molecular formula C28H26ClN9O3 and a molecular weight of 572.03 g/mol. Its IUPAC name is N-[3-amino-4-(methyliminomethyl)phenyl]-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,5-dioxopiperazin-1-yl]-3-phenylpropanamide.
| Compound Name | N-[3-amino-4-(methyliminomethyl)phenyl]-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,5-dioxopiperazin-1-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 170057215 |
| Molecular Formula | C28H26ClN9O3 |
| Molecular Weight | 572.03 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | N-[3-amino-4-(methyliminomethyl)phenyl]-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-2,5-dioxopiperazin-1-yl]-3-phenylpropanamide |
| SMILES | C/N=C/c1ccc(NC(=O)C(Cc2ccccc2)N2CC(=O)N(c3cc(Cl)ccc3-n3cnnn3)CC2=O)cc1N |
| InChI | InChI=1S/C28H26ClN9O3/c1-31-14-19-7-9-21(13-22(19)30)33-28(41)25(11-18-5-3-2-4-6-18)37-16-26(39)36(15-27(37)40)24-12-20(29)8-10-23(24)38-17-32-34-35-38/h2-10,12-14,17,25H,11,15-16,30H2,1H3,(H,33,41)/b31-14+ |
| InChIKey | HRAKXDIOSSGCES-XAZZYMPDSA-N |
| XLogP | 2.37 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.03 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|