About [(E)-but-2-en-2-yl]-(2,4-dimethylpentan-3-ylidene)phosphane
[(E)-but-2-en-2-yl]-(2,4-dimethylpentan-3-ylidene)phosphane (PubChem CID 170072320) has the molecular formula C11H21P
and a molecular weight of 184.26 g/mol. Its IUPAC name is [(E)-but-2-en-2-yl]-(2,4-dimethylpentan-3-ylidene)phosphane.
Molecular Properties
| Compound Name | [(E)-but-2-en-2-yl]-(2,4-dimethylpentan-3-ylidene)phosphane |
| PubChem CID | 170072320 |
| Molecular Formula | C11H21P |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | [(E)-but-2-en-2-yl]-(2,4-dimethylpentan-3-ylidene)phosphane |
| SMILES | C/C=C(\C)P=C(C(C)C)C(C)C |
| InChI | InChI=1S/C11H21P/c1-7-10(6)12-11(8(2)3)9(4)5/h7-9H,1-6H3/b10-7+ |
| InChIKey | XQAGFUMOKVMLTK-JXMROGBWSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(E)-but-2-en-2-yl]-(2,4-dimethylpentan-3-ylidene)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-but-2-en-2-yl]-(2,4-dimethylpentan-3-ylidene)phosphane?
The IUPAC name of [(E)-but-2-en-2-yl]-(2,4-dimethylpentan-3-ylidene)phosphane (CID 170072320) is [(E)-but-2-en-2-yl]-(2,4-dimethylpentan-3-ylidene)phosphane.
What is the SMILES notation for [(E)-but-2-en-2-yl]-(2,4-dimethylpentan-3-ylidene)phosphane?
The canonical SMILES for [(E)-but-2-en-2-yl]-(2,4-dimethylpentan-3-ylidene)phosphane is C/C=C(\C)P=C(C(C)C)C(C)C.
What is the InChIKey of [(E)-but-2-en-2-yl]-(2,4-dimethylpentan-3-ylidene)phosphane?
The InChIKey is XQAGFUMOKVMLTK-JXMROGBWSA-N. The full InChI is InChI=1S/C11H21P/c1-7-10(6)12-11(8(2)3)9(4)5/h7-9H,1-6H3/b10-7+.
What are the key properties of [(E)-but-2-en-2-yl]-(2,4-dimethylpentan-3-ylidene)phosphane?
[(E)-but-2-en-2-yl]-(2,4-dimethylpentan-3-ylidene)phosphane has a molecular weight of 184.26 g/mol, XLogP of 4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-but-2-en-2-yl]-(2,4-dimethylpentan-3-ylidene)phosphane is sourced from PubChem (CID 170072320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).