C18H18FO3P — CID 170079702
(E)-3-(3-fluoro-4-phosphanylphenyl)-1-(2-hydroxy-6-methoxy-3,5-dimethylphenyl)prop-2-en-1-one (PubChem CID 170079702) has the molecular formula C18H18FO3P and a molecular weight of 332.31 g/mol. Its IUPAC name is (E)-3-(3-fluoro-4-phosphanylphenyl)-1-(2-hydroxy-6-methoxy-3,5-dimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-fluoro-4-phosphanylphenyl)-1-(2-hydroxy-6-methoxy-3,5-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 170079702 |
| Molecular Formula | C18H18FO3P |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (E)-3-(3-fluoro-4-phosphanylphenyl)-1-(2-hydroxy-6-methoxy-3,5-dimethylphenyl)prop-2-en-1-one |
| SMILES | COc1c(C)cc(C)c(O)c1C(=O)/C=C/c1ccc(P)c(F)c1 |
| InChI | InChI=1S/C18H18FO3P/c1-10-8-11(2)18(22-3)16(17(10)21)14(20)6-4-12-5-7-15(23)13(19)9-12/h4-9,21H,23H2,1-3H3/b6-4+ |
| InChIKey | NTXYIVSZNIGUAE-GQCTYLIASA-N |
| XLogP | 3.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|