C6H13NO4S2 — CID 170087324
3-[(3-hydroxy-2-nitrosopropyl)disulfanyl]propane-1,2-diol (PubChem CID 170087324) has the molecular formula C6H13NO4S2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-[(3-hydroxy-2-nitrosopropyl)disulfanyl]propane-1,2-diol.
| Compound Name | 3-[(3-hydroxy-2-nitrosopropyl)disulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 170087324 |
| Molecular Formula | C6H13NO4S2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 3-[(3-hydroxy-2-nitrosopropyl)disulfanyl]propane-1,2-diol |
| SMILES | O=NC(CO)CSSCC(O)CO |
| InChI | InChI=1S/C6H13NO4S2/c8-1-5(7-11)3-12-13-4-6(10)2-9/h5-6,8-10H,1-4H2 |
| InChIKey | FKVBHBXVPNSEBG-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|