C22H37I — CID 170104730
5-(4,4-dimethylhexyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene (PubChem CID 170104730) has the molecular formula C22H37I and a molecular weight of 428.44 g/mol. Its IUPAC name is 5-(4,4-dimethylhexyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene.
| Compound Name | 5-(4,4-dimethylhexyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 170104730 |
| Molecular Formula | C22H37I |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 5-(4,4-dimethylhexyl)-2-(4-iodo-4-methylpentyl)-1,3-dimethylbenzene |
| SMILES | CCC(C)(C)CCCc1cc(C)c(CCCC(C)(C)I)c(C)c1 |
| InChI | InChI=1S/C22H37I/c1-8-21(4,5)13-9-11-19-15-17(2)20(18(3)16-19)12-10-14-22(6,7)23/h15-16H,8-14H2,1-7H3 |
| InChIKey | SBPBXZYDZSUUBW-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|