C21H35I — CID 170104718
4-(4,4-dimethylhexyl)-1-(4-iodo-4-methylpentyl)-2-methylbenzene (PubChem CID 170104718) has the molecular formula C21H35I and a molecular weight of 414.42 g/mol. Its IUPAC name is 4-(4,4-dimethylhexyl)-1-(4-iodo-4-methylpentyl)-2-methylbenzene.
| Compound Name | 4-(4,4-dimethylhexyl)-1-(4-iodo-4-methylpentyl)-2-methylbenzene |
|---|---|
| PubChem CID | 170104718 |
| Molecular Formula | C21H35I |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-(4,4-dimethylhexyl)-1-(4-iodo-4-methylpentyl)-2-methylbenzene |
| SMILES | CCC(C)(C)CCCc1ccc(CCCC(C)(C)I)c(C)c1 |
| InChI | InChI=1S/C21H35I/c1-7-20(3,4)14-8-10-18-12-13-19(17(2)16-18)11-9-15-21(5,6)22/h12-13,16H,7-11,14-15H2,1-6H3 |
| InChIKey | YQIWAKRTDHQCTA-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|