C25H43IO3 — CID 170104826
6-(6,6-dimethyloctyl)-3-(5-ethyl-6-iodoheptyl)benzene-1,2,4-triol (PubChem CID 170104826) has the molecular formula C25H43IO3 and a molecular weight of 518.52 g/mol. Its IUPAC name is 6-(6,6-dimethyloctyl)-3-(5-ethyl-6-iodoheptyl)benzene-1,2,4-triol.
| Compound Name | 6-(6,6-dimethyloctyl)-3-(5-ethyl-6-iodoheptyl)benzene-1,2,4-triol |
|---|---|
| PubChem CID | 170104826 |
| Molecular Formula | C25H43IO3 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 6-(6,6-dimethyloctyl)-3-(5-ethyl-6-iodoheptyl)benzene-1,2,4-triol |
| SMILES | CCC(CCCCc1c(O)cc(CCCCCC(C)(C)CC)c(O)c1O)C(C)I |
| InChI | InChI=1S/C25H43IO3/c1-6-19(18(3)26)13-10-11-15-21-22(27)17-20(23(28)24(21)29)14-9-8-12-16-25(4,5)7-2/h17-19,27-29H,6-16H2,1-5H3 |
| InChIKey | LCPKIDMTQGFFJF-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|