C28H50N2O6S2 — CID 170107844
2-[butyl-[[butyl-[2-[2-(2-methyloxan-4-yl)acetyl]oxyethyl]amino]disulfanyl]amino]ethyl 2-(7-oxabicyclo[4.1.0]heptan-3-yl)acetate (PubChem CID 170107844) has the molecular formula C28H50N2O6S2 and a molecular weight of 574.85 g/mol. Its IUPAC name is 2-[butyl-[[butyl-[2-[2-(2-methyloxan-4-yl)acetyl]oxyethyl]amino]disulfanyl]amino]ethyl 2-(7-oxabicyclo[4.1.0]heptan-3-yl)acetate.
| Compound Name | 2-[butyl-[[butyl-[2-[2-(2-methyloxan-4-yl)acetyl]oxyethyl]amino]disulfanyl]amino]ethyl 2-(7-oxabicyclo[4.1.0]heptan-3-yl)acetate |
|---|---|
| PubChem CID | 170107844 |
| Molecular Formula | C28H50N2O6S2 |
| Molecular Weight | 574.85 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | 2-[butyl-[[butyl-[2-[2-(2-methyloxan-4-yl)acetyl]oxyethyl]amino]disulfanyl]amino]ethyl 2-(7-oxabicyclo[4.1.0]heptan-3-yl)acetate |
| SMILES | CCCCN(CCOC(=O)CC1CCOC(C)C1)SSN(CCCC)CCOC(=O)CC1CCC2OC2C1 |
| InChI | InChI=1S/C28H50N2O6S2/c1-4-6-11-29(13-16-34-27(31)20-23-8-9-25-26(19-23)36-25)37-38-30(12-7-5-2)14-17-35-28(32)21-24-10-15-33-22(3)18-24/h22-26H,4-21H2,1-3H3 |
| InChIKey | RVPPTZJUVGYARK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 80.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.85 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|