C16H30O3 — CID 144582855
(2-methyloxan-4-yl)methyl 2-ethyl-2-methylhexanoate (PubChem CID 144582855) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is (2-methyloxan-4-yl)methyl 2-ethyl-2-methylhexanoate.
| Compound Name | (2-methyloxan-4-yl)methyl 2-ethyl-2-methylhexanoate |
|---|---|
| PubChem CID | 144582855 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | (2-methyloxan-4-yl)methyl 2-ethyl-2-methylhexanoate |
| SMILES | CCCCC(C)(CC)C(=O)OCC1CCOC(C)C1 |
| InChI | InChI=1S/C16H30O3/c1-5-7-9-16(4,6-2)15(17)19-12-14-8-10-18-13(3)11-14/h13-14H,5-12H2,1-4H3 |
| InChIKey | MMXPFNUWCXTDOI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |