C18H30O7S2 — CID 167130799
2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate (PubChem CID 167130799) has the molecular formula C18H30O7S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate.
| Compound Name | 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 167130799 |
| Molecular Formula | C18H30O7S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate |
| SMILES | CC1CC(COC(=O)CCSCCC(=O)OCCOC(=O)CCS)CCO1 |
| InChI | InChI=1S/C18H30O7S2/c1-14-12-15(2-6-22-14)13-25-18(21)5-11-27-10-4-17(20)24-8-7-23-16(19)3-9-26/h14-15,26H,2-13H2,1H3 |
| InChIKey | FZUQNBQEUKPLMR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|