About 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate
2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate (PubChem CID 167130799) has the molecular formula C18H30O7S2
and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate.
Molecular Properties
| Compound Name | 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate |
| PubChem CID | 167130799 |
| Molecular Formula | C18H30O7S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate |
| SMILES | CC1CC(COC(=O)CCSCCC(=O)OCCOC(=O)CCS)CCO1 |
| InChI | InChI=1S/C18H30O7S2/c1-14-12-15(2-6-22-14)13-25-18(21)5-11-27-10-4-17(20)24-8-7-23-16(19)3-9-26/h14-15,26H,2-13H2,1H3 |
| InChIKey | FZUQNBQEUKPLMR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate?
The IUPAC name of 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate (CID 167130799) is 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate.
What is the SMILES notation for 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate?
The canonical SMILES for 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate is CC1CC(COC(=O)CCSCCC(=O)OCCOC(=O)CCS)CCO1.
What is the InChIKey of 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate?
The InChIKey is FZUQNBQEUKPLMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O7S2/c1-14-12-15(2-6-22-14)13-25-18(21)5-11-27-10-4-17(20)24-8-7-23-16(19)3-9-26/h14-15,26H,2-13H2,1H3.
What are the key properties of 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate?
2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate has a molecular weight of 422.57 g/mol, XLogP of 2.26, 13 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[3-[(2-methyloxan-4-yl)methoxy]-3-oxopropyl]sulfanylpropanoyloxy]ethyl 3-sulfanylpropanoate is sourced from PubChem (CID 167130799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).