C26H33N5O3 — CID 170119213
(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-6-(ethenylamino)-N-[4-(hydroxymethyl)phenyl]hexanamide (PubChem CID 170119213) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-6-(ethenylamino)-N-[4-(hydroxymethyl)phenyl]hexanamide.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-6-(ethenylamino)-N-[4-(hydroxymethyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 170119213 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-6-(ethenylamino)-N-[4-(hydroxymethyl)phenyl]hexanamide |
| SMILES | C=CNCCCC[C@H](NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C26H33N5O3/c1-2-28-14-6-5-9-24(26(34)30-20-12-10-18(17-32)11-13-20)31-25(33)22(27)15-19-16-29-23-8-4-3-7-21(19)23/h2-4,7-8,10-13,16,22,24,28-29,32H,1,5-6,9,14-15,17,27H2,(H,30,34)(H,31,33)/t22-,24-/m0/s1 |
| InChIKey | HMEUPGNOIXIHDD-UPVQGACJSA-N |
| XLogP | 2.56 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|