C35H44N6O4 — CID 24997690
N-[[4-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]phenyl]methyl]-N-cyclohexylfuran-2-carboxamide (PubChem CID 24997690) has the molecular formula C35H44N6O4 and a molecular weight of 612.78 g/mol. Its IUPAC name is N-[[4-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]phenyl]methyl]-N-cyclohexylfuran-2-carboxamide.
| Compound Name | N-[[4-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]phenyl]methyl]-N-cyclohexylfuran-2-carboxamide |
|---|---|
| PubChem CID | 24997690 |
| Molecular Formula | C35H44N6O4 |
| Molecular Weight | 612.78 g/mol |
| Exact Mass | 612.34 |
| IUPAC Name | N-[[4-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]hexanoyl]amino]phenyl]methyl]-N-cyclohexylfuran-2-carboxamide |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)Nc1ccc(CN(C(=O)c2ccco2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C35H44N6O4/c36-19-7-6-13-31(40-33(42)29(37)21-25-22-38-30-12-5-4-11-28(25)30)34(43)39-26-17-15-24(16-18-26)23-41(27-9-2-1-3-10-27)35(44)32-14-8-20-45-32/h4-5,8,11-12,14-18,20,22,27,29,31,38H,1-3,6-7,9-10,13,19,21,23,36-37H2,(H,39,43)(H,40,42)/t29-,31-/m0/s1 |
| InChIKey | NELKADZRUOSTGG-SMCANUKXSA-N |
| XLogP | 4.86 |
| TPSA | 159.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.78 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|