C22H34O5 — CID 170119607
[(1S,2R,3S,4S,6R,7R)-4-ethenyl-3,10-dihydroxy-2,4,7,14-tetramethyl-6-tricyclo[5.4.3.01,8]tetradec-8-enyl] 2-hydroxyacetate (PubChem CID 170119607) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R)-4-ethenyl-3,10-dihydroxy-2,4,7,14-tetramethyl-6-tricyclo[5.4.3.01,8]tetradec-8-enyl] 2-hydroxyacetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R)-4-ethenyl-3,10-dihydroxy-2,4,7,14-tetramethyl-6-tricyclo[5.4.3.01,8]tetradec-8-enyl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 170119607 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R)-4-ethenyl-3,10-dihydroxy-2,4,7,14-tetramethyl-6-tricyclo[5.4.3.01,8]tetradec-8-enyl] 2-hydroxyacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CO)[C@@]2(C)C3=CC(O)C[C@@]3(CCC2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C22H34O5/c1-6-20(4)11-17(27-18(25)12-23)21(5)13(2)7-8-22(14(3)19(20)26)10-15(24)9-16(21)22/h6,9,13-15,17,19,23-24,26H,1,7-8,10-12H2,2-5H3/t13?,14-,15?,17+,19-,20+,21+,22-/m0/s1 |
| InChIKey | ARKCOLAXRJIKND-NHGXLXJTSA-N |
| XLogP | 2.60 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|