C23H26OS — CID 170127105
1-[5-ethyl-2-methyl-4-[(4Z)-3-methylidene-6-phenylhepta-4,6-dienyl]thiophen-3-yl]ethanone (PubChem CID 170127105) has the molecular formula C23H26OS and a molecular weight of 350.53 g/mol. Its IUPAC name is 1-[5-ethyl-2-methyl-4-[(4Z)-3-methylidene-6-phenylhepta-4,6-dienyl]thiophen-3-yl]ethanone.
| Compound Name | 1-[5-ethyl-2-methyl-4-[(4Z)-3-methylidene-6-phenylhepta-4,6-dienyl]thiophen-3-yl]ethanone |
|---|---|
| PubChem CID | 170127105 |
| Molecular Formula | C23H26OS |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-[5-ethyl-2-methyl-4-[(4Z)-3-methylidene-6-phenylhepta-4,6-dienyl]thiophen-3-yl]ethanone |
| SMILES | C=C(/C=C\C(=C)c1ccccc1)CCc1c(CC)sc(C)c1C(C)=O |
| InChI | InChI=1S/C23H26OS/c1-6-22-21(23(18(4)24)19(5)25-22)15-13-16(2)12-14-17(3)20-10-8-7-9-11-20/h7-12,14H,2-3,6,13,15H2,1,4-5H3/b14-12- |
| InChIKey | UOCNAUFRYZWKMG-OWBHPGMISA-N |
| XLogP | 6.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|