C13H16F4O8S — CID 170141652
4-(2,5-dihydroxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid (PubChem CID 170141652) has the molecular formula C13H16F4O8S and a molecular weight of 408.32 g/mol. Its IUPAC name is 4-(2,5-dihydroxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid.
| Compound Name | 4-(2,5-dihydroxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 170141652 |
| Molecular Formula | C13H16F4O8S |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 4-(2,5-dihydroxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl)oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
| SMILES | O=C(OCCC(F)(F)C(F)(F)S(=O)(=O)O)C1C2CC3C(OC(O)C31)C2O |
| InChI | InChI=1S/C13H16F4O8S/c14-12(15,13(16,17)26(21,22)23)1-2-24-10(19)6-4-3-5-7(6)11(20)25-9(5)8(4)18/h4-9,11,18,20H,1-3H2,(H,21,22,23) |
| InChIKey | XRMPRPZUZKEXNH-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|