C12H15NS — CID 170153515
(2R)-2-buta-1,3-dien-2-yl-3-methyl-4,5-dihydro-2H-1,3-benzothiazole (PubChem CID 170153515) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is (2R)-2-buta-1,3-dien-2-yl-3-methyl-4,5-dihydro-2H-1,3-benzothiazole.
| Compound Name | (2R)-2-buta-1,3-dien-2-yl-3-methyl-4,5-dihydro-2H-1,3-benzothiazole |
|---|---|
| PubChem CID | 170153515 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | (2R)-2-buta-1,3-dien-2-yl-3-methyl-4,5-dihydro-2H-1,3-benzothiazole |
| SMILES | C=CC(=C)[C@H]1SC2=C(CCC=C2)N1C |
| InChI | InChI=1S/C12H15NS/c1-4-9(2)12-13(3)10-7-5-6-8-11(10)14-12/h4,6,8,12H,1-2,5,7H2,3H3/t12-/m1/s1 |
| InChIKey | TZNPJVCZKFJOLK-GFCCVEGCSA-N |
| XLogP | 3.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|