C26H23N2+ — CID 170153859
N-[3-[(3Z)-penta-1,3-dien-2-yl]-8'-phenylspiro[cyclopropane-2,6'-pyrido[2,1-a]isoindol-5-ium]-1-yl]methanimine (PubChem CID 170153859) has the molecular formula C26H23N2+ and a molecular weight of 363.48 g/mol. Its IUPAC name is N-[3-[(3Z)-penta-1,3-dien-2-yl]-8'-phenylspiro[cyclopropane-2,6'-pyrido[2,1-a]isoindol-5-ium]-1-yl]methanimine.
| Compound Name | N-[3-[(3Z)-penta-1,3-dien-2-yl]-8'-phenylspiro[cyclopropane-2,6'-pyrido[2,1-a]isoindol-5-ium]-1-yl]methanimine |
|---|---|
| PubChem CID | 170153859 |
| Molecular Formula | C26H23N2+ |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-[3-[(3Z)-penta-1,3-dien-2-yl]-8'-phenylspiro[cyclopropane-2,6'-pyrido[2,1-a]isoindol-5-ium]-1-yl]methanimine |
| SMILES | C=NC1C(C(=C)/C=C\C)C12c1cc(-c3ccccc3)ccc1-c1cccc[n+]12 |
| InChI | InChI=1S/C26H23N2/c1-4-10-18(2)24-25(27-3)26(24)22-17-20(19-11-6-5-7-12-19)14-15-21(22)23-13-8-9-16-28(23)26/h4-17,24-25H,2-3H2,1H3/q+1/b10-4- |
| InChIKey | XAEKCGRLINTIRI-WMZJFQQLSA-N |
| XLogP | 5.20 |
| TPSA | 16.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|