C25H26N6OS — CID 170158360
15,17-dimethyl-5-(6-piperazin-1-yl-3-pyridinyl)-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one (PubChem CID 170158360) has the molecular formula C25H26N6OS and a molecular weight of 458.59 g/mol. Its IUPAC name is 15,17-dimethyl-5-(6-piperazin-1-yl-3-pyridinyl)-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one.
| Compound Name | 15,17-dimethyl-5-(6-piperazin-1-yl-3-pyridinyl)-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
|---|---|
| PubChem CID | 170158360 |
| Molecular Formula | C25H26N6OS |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 15,17-dimethyl-5-(6-piperazin-1-yl-3-pyridinyl)-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
| SMILES | CC1CN(C)c2c(sc3ccc4nc(-c5ccc(N6CCNCC6)nc5)ccc4c23)C(=O)N1 |
| InChI | InChI=1S/C25H26N6OS/c1-15-14-30(2)23-22-17-4-5-18(16-3-8-21(27-13-16)31-11-9-26-10-12-31)29-19(17)6-7-20(22)33-24(23)25(32)28-15/h3-8,13,15,26H,9-12,14H2,1-2H3,(H,28,32) |
| InChIKey | YBIPUXUYKURGEY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |