C30H32FN5O6S — CID 170161305
3-[6-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-ylmethyl)-1-(1,1-dihydroxythietan-3-yl)pyrrolo[2,3-b]pyridin-6-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170161305) has the molecular formula C30H32FN5O6S and a molecular weight of 609.68 g/mol. Its IUPAC name is 3-[6-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-ylmethyl)-1-(1,1-dihydroxythietan-3-yl)pyrrolo[2,3-b]pyridin-6-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-ylmethyl)-1-(1,1-dihydroxythietan-3-yl)pyrrolo[2,3-b]pyridin-6-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170161305 |
| Molecular Formula | C30H32FN5O6S |
| Molecular Weight | 609.68 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | 3-[6-[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-ylmethyl)-1-(1,1-dihydroxythietan-3-yl)pyrrolo[2,3-b]pyridin-6-yl]-7-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(ccc(-c4cc(CN5CC6COCC6C5)c5ccn(C6CS(O)(O)C6)c5n4)c3F)C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H32FN5O6S/c31-27-22(2-1-21-23(27)11-36(30(21)39)25-3-4-26(37)33-29(25)38)24-7-16(8-34-9-17-12-42-13-18(17)10-34)20-5-6-35(28(20)32-24)19-14-43(40,41)15-19/h1-2,5-7,17-19,25,40-41H,3-4,8-15H2,(H,33,37,38) |
| InChIKey | DURVJHCFSZJDMK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.68 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|