C32H43F2N5O4S — CID 170178777
2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxypyridine-2-carbonyl]amino]phenyl]sulfanylamino]ethyl pentanoate (PubChem CID 170178777) has the molecular formula C32H43F2N5O4S and a molecular weight of 631.79 g/mol. Its IUPAC name is 2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxypyridine-2-carbonyl]amino]phenyl]sulfanylamino]ethyl pentanoate.
| Compound Name | 2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxypyridine-2-carbonyl]amino]phenyl]sulfanylamino]ethyl pentanoate |
|---|---|
| PubChem CID | 170178777 |
| Molecular Formula | C32H43F2N5O4S |
| Molecular Weight | 631.79 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | 2-[[3-(6-azaspiro[2.5]octan-6-yl)-4-[[6-(4,4-difluoropiperidin-1-yl)-5-methoxypyridine-2-carbonyl]amino]phenyl]sulfanylamino]ethyl pentanoate |
| SMILES | CCCCC(=O)OCCNSc1ccc(NC(=O)c2ccc(OC)c(N3CCC(F)(F)CC3)n2)c(N2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C32H43F2N5O4S/c1-3-4-5-28(40)43-21-16-35-44-23-6-7-24(26(22-23)38-17-12-31(10-11-31)13-18-38)37-30(41)25-8-9-27(42-2)29(36-25)39-19-14-32(33,34)15-20-39/h6-9,22,35H,3-5,10-21H2,1-2H3,(H,37,41) |
| InChIKey | XDGREPCROSGVJI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.79 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|