C24H31N4O9P — CID 170194541
[(2R,3S,4R,5S)-3,4-dihydroxy-5-[3-[[hydroxy(phenylmethoxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-methyloxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 170194541) has the molecular formula C24H31N4O9P and a molecular weight of 550.51 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,4-dihydroxy-5-[3-[[hydroxy(phenylmethoxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-methyloxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(2R,3S,4R,5S)-3,4-dihydroxy-5-[3-[[hydroxy(phenylmethoxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-methyloxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 170194541 |
| Molecular Formula | C24H31N4O9P |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | [(2R,3S,4R,5S)-3,4-dihydroxy-5-[3-[[hydroxy(phenylmethoxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-methyloxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | [H]/N=c1/c2ccc([C@]3(C)O[C@H](COC(=O)C(C)C)[C@@H](O)[C@H]3O)n2ncn1COP(=O)(O)OCc1ccccc1 |
| InChI | InChI=1S/C24H31N4O9P/c1-15(2)23(31)34-12-18-20(29)21(30)24(3,37-18)19-10-9-17-22(25)27(13-26-28(17)19)14-36-38(32,33)35-11-16-7-5-4-6-8-16/h4-10,13,15,18,20-21,25,29-30H,11-12,14H2,1-3H3,(H,32,33)/b25-22-/t18-,20-,21-,24+/m1/s1 |
| InChIKey | MMKJKBHPWIBSSC-GFFJPGHBSA-N |
| XLogP | 1.44 |
| TPSA | 177.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|