C13H18N4O10P2 — CID 170229860
[(2R,3S,4R,5S)-3,4-dihydroxy-5-[3-[[hydroxy(phosphanyloxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl hydrogen carbonate (PubChem CID 170229860) has the molecular formula C13H18N4O10P2 and a molecular weight of 452.25 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,4-dihydroxy-5-[3-[[hydroxy(phosphanyloxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl hydrogen carbonate.
| Compound Name | [(2R,3S,4R,5S)-3,4-dihydroxy-5-[3-[[hydroxy(phosphanyloxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl hydrogen carbonate |
|---|---|
| PubChem CID | 170229860 |
| Molecular Formula | C13H18N4O10P2 |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | [(2R,3S,4R,5S)-3,4-dihydroxy-5-[3-[[hydroxy(phosphanyloxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl hydrogen carbonate |
| SMILES | [H]/N=c1/c2ccc([C@@H]3O[C@H](COC(=O)O)[C@@H](O)[C@H]3O)n2ncn1COP(=O)(O)OP |
| InChI | InChI=1S/C13H18N4O10P2/c14-12-7-2-1-6(11-10(19)9(18)8(26-11)3-24-13(20)21)17(7)15-4-16(12)5-25-29(22,23)27-28/h1-2,4,8-11,14,18-19H,3,5,28H2,(H,20,21)(H,22,23)/b14-12-/t8-,9-,10-,11+/m1/s1 |
| InChIKey | XYQJPXROZTXNLP-BQBKXROTSA-N |
| XLogP | -0.65 |
| TPSA | 198.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|