C30H36ClF3N6S — CID 170195530
N'-[[3-[1-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanyl-3-ethylanilino]ethenyl]phenyl]methyl]propane-1,3-diamine (PubChem CID 170195530) has the molecular formula C30H36ClF3N6S and a molecular weight of 605.17 g/mol. Its IUPAC name is N'-[[3-[1-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanyl-3-ethylanilino]ethenyl]phenyl]methyl]propane-1,3-diamine.
| Compound Name | N'-[[3-[1-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanyl-3-ethylanilino]ethenyl]phenyl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 170195530 |
| Molecular Formula | C30H36ClF3N6S |
| Molecular Weight | 605.17 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | N'-[[3-[1-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanyl-3-ethylanilino]ethenyl]phenyl]methyl]propane-1,3-diamine |
| SMILES | C=C(Nc1ccc(SN2CCN(c3cc(C(F)(F)F)cc(Cl)n3)CC2)c(CC)c1)c1cccc(CNCCCN)c1 |
| InChI | InChI=1S/C30H36ClF3N6S/c1-3-23-17-26(37-21(2)24-7-4-6-22(16-24)20-36-11-5-10-35)8-9-27(23)41-40-14-12-39(13-15-40)29-19-25(30(32,33)34)18-28(31)38-29/h4,6-9,16-19,36-37H,2-3,5,10-15,20,35H2,1H3 |
| InChIKey | XQUABCQDPABKCI-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 69.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.17 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|