C15H13BrClF3N4S — CID 169172436
1-[(6-bromo-3-pyridinyl)sulfanyl]-4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 169172436) has the molecular formula C15H13BrClF3N4S and a molecular weight of 453.72 g/mol. Its IUPAC name is 1-[(6-bromo-3-pyridinyl)sulfanyl]-4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-[(6-bromo-3-pyridinyl)sulfanyl]-4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 169172436 |
| Molecular Formula | C15H13BrClF3N4S |
| Molecular Weight | 453.72 g/mol |
| Exact Mass | 451.97 |
| IUPAC Name | 1-[(6-bromo-3-pyridinyl)sulfanyl]-4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | FC(F)(F)c1cc(Cl)nc(N2CCN(Sc3ccc(Br)nc3)CC2)c1 |
| InChI | InChI=1S/C15H13BrClF3N4S/c16-12-2-1-11(9-21-12)25-24-5-3-23(4-6-24)14-8-10(15(18,19)20)7-13(17)22-14/h1-2,7-9H,3-6H2 |
| InChIKey | DYSYOVXLEHPLIY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.72 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|