C17H18ClF3N4O2S — CID 169172352
4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-methylpiperazin-1-yl]sulfonylaniline (PubChem CID 169172352) has the molecular formula C17H18ClF3N4O2S and a molecular weight of 434.87 g/mol. Its IUPAC name is 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-methylpiperazin-1-yl]sulfonylaniline.
| Compound Name | 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-methylpiperazin-1-yl]sulfonylaniline |
|---|---|
| PubChem CID | 169172352 |
| Molecular Formula | C17H18ClF3N4O2S |
| Molecular Weight | 434.87 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-methylpiperazin-1-yl]sulfonylaniline |
| SMILES | CC1CN(c2cc(C(F)(F)F)cc(Cl)n2)CCN1S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C17H18ClF3N4O2S/c1-11-10-24(16-9-12(17(19,20)21)8-15(18)23-16)6-7-25(11)28(26,27)14-4-2-13(22)3-5-14/h2-5,8-9,11H,6-7,10,22H2,1H3 |
| InChIKey | XGQTXKBQXWNROI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.87 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|