C12H10BClF3N4O — CID 176590079
CID 176590079 (PubChem CID 176590079) has the molecular formula C12H10BClF3N4O and a molecular weight of 329.50 g/mol.
| Compound Name | CID 176590079 |
|---|---|
| PubChem CID | 176590079 |
| Molecular Formula | C12H10BClF3N4O |
| Molecular Weight | 329.50 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]C1CN(c2cc(C(F)(F)F)cc(Cl)n2)CCN1[B]C=O |
| InChI | InChI=1S/C12H10BClF3N4O/c1-18-11-6-20(2-3-21(11)13-7-22)10-5-8(12(15,16)17)4-9(14)19-10/h4-5,7,11H,2-3,6H2 |
| InChIKey | FKJVSDOWUHWBNV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|