C34H40ClF3N6S — CID 170195863
4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanyl-N-[1-[2-ethyl-5-[(5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)methyl]phenyl]ethenyl]aniline (PubChem CID 170195863) has the molecular formula C34H40ClF3N6S and a molecular weight of 657.25 g/mol. Its IUPAC name is 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanyl-N-[1-[2-ethyl-5-[(5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)methyl]phenyl]ethenyl]aniline.
| Compound Name | 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanyl-N-[1-[2-ethyl-5-[(5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)methyl]phenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 170195863 |
| Molecular Formula | C34H40ClF3N6S |
| Molecular Weight | 657.25 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | 4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfanyl-N-[1-[2-ethyl-5-[(5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl)methyl]phenyl]ethenyl]aniline |
| SMILES | C=C(Nc1ccc(SN2CCN(c3cc(C(F)(F)F)cc(Cl)n3)CC2)cc1)c1cc(CN2CCC3CN(C)CC32)ccc1CC |
| InChI | InChI=1S/C34H40ClF3N6S/c1-4-25-6-5-24(20-43-12-11-26-21-41(3)22-31(26)43)17-30(25)23(2)39-28-7-9-29(10-8-28)45-44-15-13-42(14-16-44)33-19-27(34(36,37)38)18-32(35)40-33/h5-10,17-19,26,31,39H,2,4,11-16,20-22H2,1,3H3 |
| InChIKey | DOTCLZJLIBTFDT-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 37.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.25 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|