C27H36N2 — CID 170203793
3-methyl-5-[(6R)-2-methyl-6-propylcyclohexa-1,3-dien-1-yl]-2-[(6R)-2,4,6-trimethylcyclohexa-1,3-dien-1-yl]-3H-imidazo[1,5-a]pyridine (PubChem CID 170203793) has the molecular formula C27H36N2 and a molecular weight of 388.60 g/mol. Its IUPAC name is 3-methyl-5-[(6R)-2-methyl-6-propylcyclohexa-1,3-dien-1-yl]-2-[(6R)-2,4,6-trimethylcyclohexa-1,3-dien-1-yl]-3H-imidazo[1,5-a]pyridine.
| Compound Name | 3-methyl-5-[(6R)-2-methyl-6-propylcyclohexa-1,3-dien-1-yl]-2-[(6R)-2,4,6-trimethylcyclohexa-1,3-dien-1-yl]-3H-imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 170203793 |
| Molecular Formula | C27H36N2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | 3-methyl-5-[(6R)-2-methyl-6-propylcyclohexa-1,3-dien-1-yl]-2-[(6R)-2,4,6-trimethylcyclohexa-1,3-dien-1-yl]-3H-imidazo[1,5-a]pyridine |
| SMILES | CCC[C@@H]1CC=CC(C)=C1C1=CC=CC2=CN(C3=C(C)C=C(C)C[C@H]3C)C(C)N21 |
| InChI | InChI=1S/C27H36N2/c1-7-10-23-12-8-11-19(3)26(23)25-14-9-13-24-17-28(22(6)29(24)25)27-20(4)15-18(2)16-21(27)5/h8-9,11,13-15,17,21-23H,7,10,12,16H2,1-6H3/t21-,22?,23-/m1/s1 |
| InChIKey | KLISGMXVJBAWGD-OJVMETQDSA-N |
| XLogP | 7.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |