C28H38N2 — CID 170204096
5-[(6R)-2,5-dimethyl-6-propylcyclohexa-1,3-dien-1-yl]-3-methyl-2-[(6R)-2,4,6-trimethylcyclohexa-1,3-dien-1-yl]-3H-imidazo[1,5-a]pyridine (PubChem CID 170204096) has the molecular formula C28H38N2 and a molecular weight of 402.63 g/mol. Its IUPAC name is 5-[(6R)-2,5-dimethyl-6-propylcyclohexa-1,3-dien-1-yl]-3-methyl-2-[(6R)-2,4,6-trimethylcyclohexa-1,3-dien-1-yl]-3H-imidazo[1,5-a]pyridine.
| Compound Name | 5-[(6R)-2,5-dimethyl-6-propylcyclohexa-1,3-dien-1-yl]-3-methyl-2-[(6R)-2,4,6-trimethylcyclohexa-1,3-dien-1-yl]-3H-imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 170204096 |
| Molecular Formula | C28H38N2 |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | 5-[(6R)-2,5-dimethyl-6-propylcyclohexa-1,3-dien-1-yl]-3-methyl-2-[(6R)-2,4,6-trimethylcyclohexa-1,3-dien-1-yl]-3H-imidazo[1,5-a]pyridine |
| SMILES | CCC[C@H]1C(C2=CC=CC3=CN(C4=C(C)C=C(C)C[C@H]4C)C(C)N32)=C(C)C=CC1C |
| InChI | InChI=1S/C28H38N2/c1-8-10-25-19(3)13-14-20(4)27(25)26-12-9-11-24-17-29(23(7)30(24)26)28-21(5)15-18(2)16-22(28)6/h9,11-15,17,19,22-23,25H,8,10,16H2,1-7H3/t19?,22-,23?,25-/m1/s1 |
| InChIKey | USLLHKCNBYHHTK-PVDXNQTMSA-N |
| XLogP | 7.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |