C15H26O3 — CID 170207977
(4'aS,8'aS)-4',4',8',8'a-tetramethylspiro[1,2,4-trioxolane-3,7'-2,3,4a,5,6,8-hexahydro-1H-naphthalene] (PubChem CID 170207977) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (4'aS,8'aS)-4',4',8',8'a-tetramethylspiro[1,2,4-trioxolane-3,7'-2,3,4a,5,6,8-hexahydro-1H-naphthalene].
| Compound Name | (4'aS,8'aS)-4',4',8',8'a-tetramethylspiro[1,2,4-trioxolane-3,7'-2,3,4a,5,6,8-hexahydro-1H-naphthalene] |
|---|---|
| PubChem CID | 170207977 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (4'aS,8'aS)-4',4',8',8'a-tetramethylspiro[1,2,4-trioxolane-3,7'-2,3,4a,5,6,8-hexahydro-1H-naphthalene] |
| SMILES | CC1C2(CC[C@H]3C(C)(C)CCC[C@]13C)OCOO2 |
| InChI | InChI=1S/C15H26O3/c1-11-14(4)8-5-7-13(2,3)12(14)6-9-15(11)16-10-17-18-15/h11-12H,5-10H2,1-4H3/t11?,12-,14+,15?/m0/s1 |
| InChIKey | OQZHWSAWIVRGQS-HCWKNACYSA-N |
| XLogP | 3.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|