C14H18O10S2 — CID 170225244
2-[2-(2-methylprop-2-enoyloxy)-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonic acid (PubChem CID 170225244) has the molecular formula C14H18O10S2 and a molecular weight of 410.42 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enoyloxy)-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonic acid.
| Compound Name | 2-[2-(2-methylprop-2-enoyloxy)-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 170225244 |
| Molecular Formula | C14H18O10S2 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 2-[2-(2-methylprop-2-enoyloxy)-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonic acid |
| SMILES | C=C(C)C(=O)OC1C2CC3C1OS(=O)(=O)C3C2C(=O)OCCS(=O)(=O)O |
| InChI | InChI=1S/C14H18O10S2/c1-6(2)13(15)23-10-7-5-8-11(10)24-26(20,21)12(8)9(7)14(16)22-3-4-25(17,18)19/h7-12H,1,3-5H2,2H3,(H,17,18,19) |
| InChIKey | NTEHRKJEDXDWKO-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|