C27H25N3 — CID 170231692
14-(2,2-dimethylpropyl)-3,5-dimethyl-1,9,11-triazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16,18,20-undecaene (PubChem CID 170231692) has the molecular formula C27H25N3 and a molecular weight of 391.52 g/mol. Its IUPAC name is 14-(2,2-dimethylpropyl)-3,5-dimethyl-1,9,11-triazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16,18,20-undecaene.
| Compound Name | 14-(2,2-dimethylpropyl)-3,5-dimethyl-1,9,11-triazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16,18,20-undecaene |
|---|---|
| PubChem CID | 170231692 |
| Molecular Formula | C27H25N3 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 14-(2,2-dimethylpropyl)-3,5-dimethyl-1,9,11-triazahexacyclo[10.9.2.02,7.08,23.015,22.016,21]tricosa-2,4,6,8,10,12(23),13,15(22),16,18,20-undecaene |
| SMILES | Cc1cc(C)c2c(c1)c1ncnc3cc(CC(C)(C)C)c4c5ccccc5n2c4c31 |
| InChI | InChI=1S/C27H25N3/c1-15-10-16(2)25-19(11-15)24-23-20(28-14-29-24)12-17(13-27(3,4)5)22-18-8-6-7-9-21(18)30(25)26(22)23/h6-12,14H,13H2,1-5H3 |
| InChIKey | XNMCXJHPPOLZFH-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|