C21H16FNOS — CID 170246837
[4-[2-[4-(cyclopenten-1-ylmethoxy)phenyl]ethynyl]-2-fluorophenyl] thiocyanate (PubChem CID 170246837) has the molecular formula C21H16FNOS and a molecular weight of 349.43 g/mol. Its IUPAC name is [4-[2-[4-(cyclopenten-1-ylmethoxy)phenyl]ethynyl]-2-fluorophenyl] thiocyanate.
| Compound Name | [4-[2-[4-(cyclopenten-1-ylmethoxy)phenyl]ethynyl]-2-fluorophenyl] thiocyanate |
|---|---|
| PubChem CID | 170246837 |
| Molecular Formula | C21H16FNOS |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | [4-[2-[4-(cyclopenten-1-ylmethoxy)phenyl]ethynyl]-2-fluorophenyl] thiocyanate |
| SMILES | N#CSc1ccc(C#Cc2ccc(OCC3=CCCC3)cc2)cc1F |
| InChI | InChI=1S/C21H16FNOS/c22-20-13-17(9-12-21(20)25-15-23)6-5-16-7-10-19(11-8-16)24-14-18-3-1-2-4-18/h3,7-13H,1-2,4,14H2 |
| InChIKey | LYFHUWAAINGWNY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|