C17H23N3O4 — CID 170247105
N-(2,6-dioxopiperidin-3-yl)-6-formyl-N-methyl-5-(propan-2-ylamino)cyclohexa-1,5-diene-1-carboxamide (PubChem CID 170247105) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-6-formyl-N-methyl-5-(propan-2-ylamino)cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-6-formyl-N-methyl-5-(propan-2-ylamino)cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 170247105 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-6-formyl-N-methyl-5-(propan-2-ylamino)cyclohexa-1,5-diene-1-carboxamide |
| SMILES | CC(C)NC1=C(C=O)C(C(=O)N(C)C2CCC(=O)NC2=O)=CCC1 |
| InChI | InChI=1S/C17H23N3O4/c1-10(2)18-13-6-4-5-11(12(13)9-21)17(24)20(3)14-7-8-15(22)19-16(14)23/h5,9-10,14,18H,4,6-8H2,1-3H3,(H,19,22,23) |
| InChIKey | WGOZWEHUPPFTGM-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|