C24H22O2 — CID 170248216
(2E,4Z)-2-ethenyl-5-methyl-1-[4-(4-methylbenzoyl)phenyl]hepta-2,4,6-trien-1-one (PubChem CID 170248216) has the molecular formula C24H22O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2E,4Z)-2-ethenyl-5-methyl-1-[4-(4-methylbenzoyl)phenyl]hepta-2,4,6-trien-1-one.
| Compound Name | (2E,4Z)-2-ethenyl-5-methyl-1-[4-(4-methylbenzoyl)phenyl]hepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 170248216 |
| Molecular Formula | C24H22O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2E,4Z)-2-ethenyl-5-methyl-1-[4-(4-methylbenzoyl)phenyl]hepta-2,4,6-trien-1-one |
| SMILES | C=C/C(C)=C\C=C(/C=C)C(=O)c1ccc(C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H22O2/c1-5-17(3)7-10-19(6-2)23(25)21-13-15-22(16-14-21)24(26)20-11-8-18(4)9-12-20/h5-16H,1-2H2,3-4H3/b17-7-,19-10+ |
| InChIKey | VQMJZSHGYLEESG-VMDXYKMYSA-N |
| XLogP | 5.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|