C32H46O5S — CID 170249282
3-[2-(benzenesulfonyl)-3-[(17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]oxolan-3-ol (PubChem CID 170249282) has the molecular formula C32H46O5S and a molecular weight of 542.78 g/mol. Its IUPAC name is 3-[2-(benzenesulfonyl)-3-[(17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]oxolan-3-ol.
| Compound Name | 3-[2-(benzenesulfonyl)-3-[(17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]oxolan-3-ol |
|---|---|
| PubChem CID | 170249282 |
| Molecular Formula | C32H46O5S |
| Molecular Weight | 542.78 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | 3-[2-(benzenesulfonyl)-3-[(17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]oxolan-3-ol |
| SMILES | CC12CCC(O)CC1=CCC1C2CCC2(C)C1CC[C@@H]2CC(CC1(O)CCOC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H46O5S/c1-30-14-12-24(33)18-22(30)8-10-27-28-11-9-23(31(28,2)15-13-29(27)30)19-26(20-32(34)16-17-37-21-32)38(35,36)25-6-4-3-5-7-25/h3-8,23-24,26-29,33-34H,9-21H2,1-2H3/t23-,24?,26?,27?,28?,29?,30?,31?,32?/m1/s1 |
| InChIKey | YYBUNBJQPUXSHG-IKYVEZRTSA-N |
| XLogP | 5.70 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.78 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|