C36H54O4S — CID 134451773
(17R)-17-[2-(benzenesulfonyl)-3-(1-hydroxy-4,4-dimethylcyclohexyl)propyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 134451773) has the molecular formula C36H54O4S and a molecular weight of 582.89 g/mol. Its IUPAC name is (17R)-17-[2-(benzenesulfonyl)-3-(1-hydroxy-4,4-dimethylcyclohexyl)propyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (17R)-17-[2-(benzenesulfonyl)-3-(1-hydroxy-4,4-dimethylcyclohexyl)propyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 134451773 |
| Molecular Formula | C36H54O4S |
| Molecular Weight | 582.89 g/mol |
| Exact Mass | 582.37 |
| IUPAC Name | (17R)-17-[2-(benzenesulfonyl)-3-(1-hydroxy-4,4-dimethylcyclohexyl)propyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC1(C)CCC(O)(CC(C[C@H]2CCC3C4CC=C5CC(O)CCC5(C)C4CCC32C)S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C36H54O4S/c1-33(2)18-20-36(38,21-19-33)24-29(41(39,40)28-8-6-5-7-9-28)23-26-11-13-31-30-12-10-25-22-27(37)14-16-34(25,3)32(30)15-17-35(26,31)4/h5-10,26-27,29-32,37-38H,11-24H2,1-4H3/t26-,27?,29?,30?,31?,32?,34?,35?/m1/s1 |
| InChIKey | SIAVFQPFXUEYRU-ZNBDWBHISA-N |
| XLogP | 7.88 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.89 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|