C21H23ClN6O4S — CID 170281331
4-[3-chloro-2-[methyl(methylsulfinyl)amino]anilino]-N-methoxy-6-[(2-methoxy-3-pyridinyl)amino]pyridine-3-carboxamide (PubChem CID 170281331) has the molecular formula C21H23ClN6O4S and a molecular weight of 490.97 g/mol. Its IUPAC name is 4-[3-chloro-2-[methyl(methylsulfinyl)amino]anilino]-N-methoxy-6-[(2-methoxy-3-pyridinyl)amino]pyridine-3-carboxamide.
| Compound Name | 4-[3-chloro-2-[methyl(methylsulfinyl)amino]anilino]-N-methoxy-6-[(2-methoxy-3-pyridinyl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170281331 |
| Molecular Formula | C21H23ClN6O4S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 4-[3-chloro-2-[methyl(methylsulfinyl)amino]anilino]-N-methoxy-6-[(2-methoxy-3-pyridinyl)amino]pyridine-3-carboxamide |
| SMILES | CONC(=O)c1cnc(Nc2cccnc2OC)cc1Nc1cccc(Cl)c1N(C)S(C)=O |
| InChI | InChI=1S/C21H23ClN6O4S/c1-28(33(4)30)19-14(22)7-5-8-15(19)25-17-11-18(24-12-13(17)20(29)27-32-3)26-16-9-6-10-23-21(16)31-2/h5-12H,1-4H3,(H,27,29)(H2,24,25,26) |
| InChIKey | XIYSLCQVNSFSPN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|