C21H25FN4O — CID 170338580
3-[4-[1-[4-(2-fluoropropan-2-yloxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-N-methylpropan-1-amine (PubChem CID 170338580) has the molecular formula C21H25FN4O and a molecular weight of 368.46 g/mol. Its IUPAC name is 3-[4-[1-[4-(2-fluoropropan-2-yloxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-N-methylpropan-1-amine.
| Compound Name | 3-[4-[1-[4-(2-fluoropropan-2-yloxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 170338580 |
| Molecular Formula | C21H25FN4O |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 3-[4-[1-[4-(2-fluoropropan-2-yloxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-N-methylpropan-1-amine |
| SMILES | CNCCCc1ccc(-c2ncn(-c3ccc(OC(C)(C)F)cc3)n2)cc1 |
| InChI | InChI=1S/C21H25FN4O/c1-21(2,22)27-19-12-10-18(11-13-19)26-15-24-20(25-26)17-8-6-16(7-9-17)5-4-14-23-3/h6-13,15,23H,4-5,14H2,1-3H3 |
| InChIKey | PPORJWWZTMUQRV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|