C21H30ClN7O6 — CID 170354528
[5-[[(2S)-2-[[(2S)-2-(2-azidoethoxycarbonylamino)-3-methylbutanoyl]amino]propanoyl]amino]-2-(chloromethyl)phenyl]methyl-methylcarbamic acid (PubChem CID 170354528) has the molecular formula C21H30ClN7O6 and a molecular weight of 511.97 g/mol. Its IUPAC name is [5-[[(2S)-2-[[(2S)-2-(2-azidoethoxycarbonylamino)-3-methylbutanoyl]amino]propanoyl]amino]-2-(chloromethyl)phenyl]methyl-methylcarbamic acid.
| Compound Name | [5-[[(2S)-2-[[(2S)-2-(2-azidoethoxycarbonylamino)-3-methylbutanoyl]amino]propanoyl]amino]-2-(chloromethyl)phenyl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 170354528 |
| Molecular Formula | C21H30ClN7O6 |
| Molecular Weight | 511.97 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | [5-[[(2S)-2-[[(2S)-2-(2-azidoethoxycarbonylamino)-3-methylbutanoyl]amino]propanoyl]amino]-2-(chloromethyl)phenyl]methyl-methylcarbamic acid |
| SMILES | CC(C)[C@H](NC(=O)OCCN=[N+]=[N-])C(=O)N[C@@H](C)C(=O)Nc1ccc(CCl)c(CN(C)C(=O)O)c1 |
| InChI | InChI=1S/C21H30ClN7O6/c1-12(2)17(27-20(32)35-8-7-24-28-23)19(31)25-13(3)18(30)26-16-6-5-14(10-22)15(9-16)11-29(4)21(33)34/h5-6,9,12-13,17H,7-8,10-11H2,1-4H3,(H,25,31)(H,26,30)(H,27,32)(H,33,34)/t13-,17-/m0/s1 |
| InChIKey | MQANHYLJDHPHAU-GUYCJALGSA-N |
| XLogP | 3.04 |
| TPSA | 185.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.97 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|